C25H26F6N2O4S — CID 86598344
[(3R,7S,9aR)-3-benzyl-2-[3,5-bis(trifluoromethyl)benzoyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl] methanesulfonate (PubChem CID 86598344) has the molecular formula C25H26F6N2O4S and a molecular weight of 564.55 g/mol. Its IUPAC name is [(3R,7S,9aR)-3-benzyl-2-[3,5-bis(trifluoromethyl)benzoyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl] methanesulfonate.
| Compound Name | [(3R,7S,9aR)-3-benzyl-2-[3,5-bis(trifluoromethyl)benzoyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl] methanesulfonate |
|---|---|
| PubChem CID | 86598344 |
| Molecular Formula | C25H26F6N2O4S |
| Molecular Weight | 564.55 g/mol |
| Exact Mass | 564.15 |
| IUPAC Name | [(3R,7S,9aR)-3-benzyl-2-[3,5-bis(trifluoromethyl)benzoyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@H]1CC[C@@H]2CN(C(=O)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)[C@H](Cc3ccccc3)CN2C1 |
| InChI | InChI=1S/C25H26F6N2O4S/c1-38(35,36)37-22-8-7-20-14-33(21(13-32(20)15-22)9-16-5-3-2-4-6-16)23(34)17-10-18(24(26,27)28)12-19(11-17)25(29,30)31/h2-6,10-12,20-22H,7-9,13-15H2,1H3/t20-,21-,22+/m1/s1 |
| InChIKey | SKRCKCSFDGFDHF-VSKRKVRLSA-N |
| XLogP | 4.60 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.55 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|