C17H22O3 — CID 86600725
6-methoxy-5-prop-1-en-2-yl-2,3-dihydro-1,4-benzodioxine;2-methylbuta-1,3-diene (PubChem CID 86600725) has the molecular formula C17H22O3 and a molecular weight of 274.36 g/mol. Its IUPAC name is 6-methoxy-5-prop-1-en-2-yl-2,3-dihydro-1,4-benzodioxine;2-methylbuta-1,3-diene.
| Compound Name | 6-methoxy-5-prop-1-en-2-yl-2,3-dihydro-1,4-benzodioxine;2-methylbuta-1,3-diene |
|---|---|
| PubChem CID | 86600725 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | 6-methoxy-5-prop-1-en-2-yl-2,3-dihydro-1,4-benzodioxine;2-methylbuta-1,3-diene |
| SMILES | C=C(C)c1c(OC)ccc2c1OCCO2.C=CC(=C)C |
| InChI | InChI=1S/C12H14O3.C5H8/c1-8(2)11-9(13-3)4-5-10-12(11)15-7-6-14-10;1-4-5(2)3/h4-5H,1,6-7H2,2-3H3;4H,1-2H2,3H3 |
| InChIKey | ICGJQTJZYAOQBM-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|