C20H24N2O3S — CID 86601726
4-[[5-(dimethylamino)-5-methyl-1,2,3,4-tetrahydro-3-benzazepin-8-yl]sulfonyl]benzaldehyde (PubChem CID 86601726) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is 4-[[5-(dimethylamino)-5-methyl-1,2,3,4-tetrahydro-3-benzazepin-8-yl]sulfonyl]benzaldehyde.
| Compound Name | 4-[[5-(dimethylamino)-5-methyl-1,2,3,4-tetrahydro-3-benzazepin-8-yl]sulfonyl]benzaldehyde |
|---|---|
| PubChem CID | 86601726 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 4-[[5-(dimethylamino)-5-methyl-1,2,3,4-tetrahydro-3-benzazepin-8-yl]sulfonyl]benzaldehyde |
| SMILES | CN(C)C1(C)CNCCc2cc(S(=O)(=O)c3ccc(C=O)cc3)ccc21 |
| InChI | InChI=1S/C20H24N2O3S/c1-20(22(2)3)14-21-11-10-16-12-18(8-9-19(16)20)26(24,25)17-6-4-15(13-23)5-7-17/h4-9,12-13,21H,10-11,14H2,1-3H3 |
| InChIKey | JWDQXMOMSSBWPT-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|