C20H28F3N3O6S — CID 86601817
tert-butyl 4-[4-morpholin-4-yl-2-(trifluoromethylsulfonyloxy)phenyl]piperazine-1-carboxylate (PubChem CID 86601817) has the molecular formula C20H28F3N3O6S and a molecular weight of 495.52 g/mol. Its IUPAC name is tert-butyl 4-[4-morpholin-4-yl-2-(trifluoromethylsulfonyloxy)phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-morpholin-4-yl-2-(trifluoromethylsulfonyloxy)phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 86601817 |
| Molecular Formula | C20H28F3N3O6S |
| Molecular Weight | 495.52 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | tert-butyl 4-[4-morpholin-4-yl-2-(trifluoromethylsulfonyloxy)phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(N3CCOCC3)cc2OS(=O)(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C20H28F3N3O6S/c1-19(2,3)31-18(27)26-8-6-25(7-9-26)16-5-4-15(24-10-12-30-13-11-24)14-17(16)32-33(28,29)20(21,22)23/h4-5,14H,6-13H2,1-3H3 |
| InChIKey | RTTSWTSVNRUREM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 88.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.52 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|