C22H25ClN4O5 — CID 86605962
benzyl N-[(3R)-1-[5-[[2-(2-chloroethoxy)acetyl]amino]-6-methyl-2-pyridinyl]-5-oxopyrrolidin-3-yl]carbamate (PubChem CID 86605962) has the molecular formula C22H25ClN4O5 and a molecular weight of 460.92 g/mol. Its IUPAC name is benzyl N-[(3R)-1-[5-[[2-(2-chloroethoxy)acetyl]amino]-6-methyl-2-pyridinyl]-5-oxopyrrolidin-3-yl]carbamate.
| Compound Name | benzyl N-[(3R)-1-[5-[[2-(2-chloroethoxy)acetyl]amino]-6-methyl-2-pyridinyl]-5-oxopyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 86605962 |
| Molecular Formula | C22H25ClN4O5 |
| Molecular Weight | 460.92 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | benzyl N-[(3R)-1-[5-[[2-(2-chloroethoxy)acetyl]amino]-6-methyl-2-pyridinyl]-5-oxopyrrolidin-3-yl]carbamate |
| SMILES | Cc1nc(N2C[C@H](NC(=O)OCc3ccccc3)CC2=O)ccc1NC(=O)COCCCl |
| InChI | InChI=1S/C22H25ClN4O5/c1-15-18(26-20(28)14-31-10-9-23)7-8-19(24-15)27-12-17(11-21(27)29)25-22(30)32-13-16-5-3-2-4-6-16/h2-8,17H,9-14H2,1H3,(H,25,30)(H,26,28)/t17-/m1/s1 |
| InChIKey | UPGOTOHYZQLOSD-QGZVFWFLSA-N |
| XLogP | 2.62 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.92 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|