C38H34N3O6P — CID 86608202
[(3R,4R)-3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-4-(1H-indol-3-yl)-2,5-dioxopyrrolidin-1-yl]methyl dibenzyl phosphate (PubChem CID 86608202) has the molecular formula C38H34N3O6P and a molecular weight of 659.68 g/mol. Its IUPAC name is [(3R,4R)-3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-4-(1H-indol-3-yl)-2,5-dioxopyrrolidin-1-yl]methyl dibenzyl phosphate.
| Compound Name | [(3R,4R)-3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-4-(1H-indol-3-yl)-2,5-dioxopyrrolidin-1-yl]methyl dibenzyl phosphate |
|---|---|
| PubChem CID | 86608202 |
| Molecular Formula | C38H34N3O6P |
| Molecular Weight | 659.68 g/mol |
| Exact Mass | 659.22 |
| IUPAC Name | [(3R,4R)-3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-4-(1H-indol-3-yl)-2,5-dioxopyrrolidin-1-yl]methyl dibenzyl phosphate |
| SMILES | O=C1[C@@H](c2c[nH]c3ccccc23)[C@H](c2cn3c4c(cccc24)CCC3)C(=O)N1COP(=O)(OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C38H34N3O6P/c42-37-34(31-21-39-33-19-8-7-17-29(31)33)35(32-22-40-20-10-16-28-15-9-18-30(32)36(28)40)38(43)41(37)25-47-48(44,45-23-26-11-3-1-4-12-26)46-24-27-13-5-2-6-14-27/h1-9,11-15,17-19,21-22,34-35,39H,10,16,20,23-25H2/t34-,35-/m0/s1 |
| InChIKey | CERMWDQSQWFRBF-PXLJZGITSA-N |
| XLogP | 7.82 |
| TPSA | 102.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.68 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|