C34H32BrF6N5O4 — CID 86610705
ethyl (2R,4S)-4-[[[3,5-bis(trifluoromethyl)phenyl]-(5-bromo-4-phenylmethoxypyrimidin-2-yl)methyl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate (PubChem CID 86610705) has the molecular formula C34H32BrF6N5O4 and a molecular weight of 768.55 g/mol. Its IUPAC name is ethyl (2R,4S)-4-[[[3,5-bis(trifluoromethyl)phenyl]-(5-bromo-4-phenylmethoxypyrimidin-2-yl)methyl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate.
| Compound Name | ethyl (2R,4S)-4-[[[3,5-bis(trifluoromethyl)phenyl]-(5-bromo-4-phenylmethoxypyrimidin-2-yl)methyl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate |
|---|---|
| PubChem CID | 86610705 |
| Molecular Formula | C34H32BrF6N5O4 |
| Molecular Weight | 768.55 g/mol |
| Exact Mass | 767.15 |
| IUPAC Name | ethyl (2R,4S)-4-[[[3,5-bis(trifluoromethyl)phenyl]-(5-bromo-4-phenylmethoxypyrimidin-2-yl)methyl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate |
| SMILES | CCOC(=O)N1c2ccc(OC)nc2[C@@H](NC(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2ncc(Br)c(OCc3ccccc3)n2)C[C@H]1CC |
| InChI | InChI=1S/C34H32BrF6N5O4/c1-4-23-16-25(29-26(11-12-27(44-29)48-3)46(23)32(47)49-5-2)43-28(20-13-21(33(36,37)38)15-22(14-20)34(39,40)41)30-42-17-24(35)31(45-30)50-18-19-9-7-6-8-10-19/h6-15,17,23,25,28,43H,4-5,16,18H2,1-3H3/t23-,25+,28?/m1/s1 |
| InChIKey | SXDGSRWGEQQCRX-WBUDJUEKSA-N |
| XLogP | 8.82 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.55 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |