C13H9ClN2O2S — CID 86611807
ethyl (E)-3-(4-chloro-5-cyanothieno[2,3-b]pyridin-2-yl)prop-2-enoate (PubChem CID 86611807) has the molecular formula C13H9ClN2O2S and a molecular weight of 292.75 g/mol. Its IUPAC name is ethyl (E)-3-(4-chloro-5-cyanothieno[2,3-b]pyridin-2-yl)prop-2-enoate.
| Compound Name | ethyl (E)-3-(4-chloro-5-cyanothieno[2,3-b]pyridin-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 86611807 |
| Molecular Formula | C13H9ClN2O2S |
| Molecular Weight | 292.75 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | ethyl (E)-3-(4-chloro-5-cyanothieno[2,3-b]pyridin-2-yl)prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cc2c(Cl)c(C#N)cnc2s1 |
| InChI | InChI=1S/C13H9ClN2O2S/c1-2-18-11(17)4-3-9-5-10-12(14)8(6-15)7-16-13(10)19-9/h3-5,7H,2H2,1H3/b4-3+ |
| InChIKey | ISNJHLWFWSYTAT-ONEGZZNKSA-N |
| XLogP | 3.40 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.75 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|