C22H24FNO3 — CID 8661448
[(2R)-1-(benzylamino)-1-oxopropan-2-yl] 1-(2-fluorophenyl)cyclopentane-1-carboxylate (PubChem CID 8661448) has the molecular formula C22H24FNO3 and a molecular weight of 369.44 g/mol. Its IUPAC name is [(2R)-1-(benzylamino)-1-oxopropan-2-yl] 1-(2-fluorophenyl)cyclopentane-1-carboxylate.
| Compound Name | [(2R)-1-(benzylamino)-1-oxopropan-2-yl] 1-(2-fluorophenyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 8661448 |
| Molecular Formula | C22H24FNO3 |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | [(2R)-1-(benzylamino)-1-oxopropan-2-yl] 1-(2-fluorophenyl)cyclopentane-1-carboxylate |
| SMILES | C[C@@H](OC(=O)C1(c2ccccc2F)CCCC1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C22H24FNO3/c1-16(20(25)24-15-17-9-3-2-4-10-17)27-21(26)22(13-7-8-14-22)18-11-5-6-12-19(18)23/h2-6,9-12,16H,7-8,13-15H2,1H3,(H,24,25)/t16-/m1/s1 |
| InChIKey | WKVNBCCWNROXNP-MRXNPFEDSA-N |
| XLogP | 3.89 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |