C10H5Br2ClN2 — CID 86616976
2,5-dibromo-3-(4-chlorophenyl)pyrazine (PubChem CID 86616976) has the molecular formula C10H5Br2ClN2 and a molecular weight of 348.43 g/mol. Its IUPAC name is 2,5-dibromo-3-(4-chlorophenyl)pyrazine.
| Compound Name | 2,5-dibromo-3-(4-chlorophenyl)pyrazine |
|---|---|
| PubChem CID | 86616976 |
| Molecular Formula | C10H5Br2ClN2 |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 345.85 |
| IUPAC Name | 2,5-dibromo-3-(4-chlorophenyl)pyrazine |
| SMILES | Clc1ccc(-c2nc(Br)cnc2Br)cc1 |
| InChI | InChI=1S/C10H5Br2ClN2/c11-8-5-14-10(12)9(15-8)6-1-3-7(13)4-2-6/h1-5H |
| InChIKey | INOAXJJTEWLQBI-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |