C22H21NO5S — CID 86619240
6-[(6-sulfopyren-1-yl)amino]hexanoic acid (PubChem CID 86619240) has the molecular formula C22H21NO5S and a molecular weight of 411.48 g/mol. Its IUPAC name is 6-[(6-sulfopyren-1-yl)amino]hexanoic acid.
| Compound Name | 6-[(6-sulfopyren-1-yl)amino]hexanoic acid |
|---|---|
| PubChem CID | 86619240 |
| Molecular Formula | C22H21NO5S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | 6-[(6-sulfopyren-1-yl)amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNc1ccc2ccc3c(S(=O)(=O)O)ccc4ccc1c2c43 |
| InChI | InChI=1S/C22H21NO5S/c24-20(25)4-2-1-3-13-23-18-11-7-14-6-10-17-19(29(26,27)28)12-8-15-5-9-16(18)21(14)22(15)17/h5-12,23H,1-4,13H2,(H,24,25)(H,26,27,28) |
| InChIKey | TUTCFNAZTXVZSA-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|