C28H27NO2 — CID 86619817
ethyl 2-[(3S)-3-[4-(benzhydrylideneamino)phenyl]cyclopentylidene]acetate (PubChem CID 86619817) has the molecular formula C28H27NO2 and a molecular weight of 409.53 g/mol. Its IUPAC name is ethyl 2-[(3S)-3-[4-(benzhydrylideneamino)phenyl]cyclopentylidene]acetate.
| Compound Name | ethyl 2-[(3S)-3-[4-(benzhydrylideneamino)phenyl]cyclopentylidene]acetate |
|---|---|
| PubChem CID | 86619817 |
| Molecular Formula | C28H27NO2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | ethyl 2-[(3S)-3-[4-(benzhydrylideneamino)phenyl]cyclopentylidene]acetate |
| SMILES | CCOC(=O)C=C1CC[C@H](c2ccc(N=C(c3ccccc3)c3ccccc3)cc2)C1 |
| InChI | InChI=1S/C28H27NO2/c1-2-31-27(30)20-21-13-14-25(19-21)22-15-17-26(18-16-22)29-28(23-9-5-3-6-10-23)24-11-7-4-8-12-24/h3-12,15-18,20,25H,2,13-14,19H2,1H3/t25-/m0/s1 |
| InChIKey | CMUVRQPXTLWQMJ-VWLOTQADSA-N |
| XLogP | 6.61 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|