C12H9ClF2N2S2 — CID 86619883
4-Chloro-2-[(2,3-difluorobenzyl)thio]-6-(methylthio)pyrimidine (PubChem CID 86619883) has the molecular formula C12H9ClF2N2S2 and a molecular weight of 318.80 g/mol. Its IUPAC name is 4-chloro-2-[(2,3-difluorophenyl)methylsulfanyl]-6-methylsulfanylpyrimidine.
| Compound Name | 4-Chloro-2-[(2,3-difluorobenzyl)thio]-6-(methylthio)pyrimidine |
|---|---|
| PubChem CID | 86619883 |
| Molecular Formula | C12H9ClF2N2S2 |
| Molecular Weight | 318.80 g/mol |
| Exact Mass | 317.99 |
| IUPAC Name | 4-chloro-2-[(2,3-difluorophenyl)methylsulfanyl]-6-methylsulfanylpyrimidine |
| SMILES | CSC1=CC(=NC(=N1)SCC2=C(C(=CC=C2)F)F)Cl |
| InChI | InChI=1S/C12H9ClF2N2S2/c1-18-10-5-9(13)16-12(17-10)19-6-7-3-2-4-8(14)11(7)15/h2-5H,6H2,1H3 |
| InChIKey | OVJJWIBETWEMTI-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 76.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | 288 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.80 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |