C36H39NO3 — CID 86621731
(4R,4aS,7aS,12bS)-3-(cyclopropylmethyl)-9-phenylmethoxy-4a-(3-phenylprop-2-enoxy)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline (PubChem CID 86621731) has the molecular formula C36H39NO3 and a molecular weight of 533.71 g/mol. Its IUPAC name is (4R,4aS,7aS,12bS)-3-(cyclopropylmethyl)-9-phenylmethoxy-4a-(3-phenylprop-2-enoxy)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline.
| Compound Name | (4R,4aS,7aS,12bS)-3-(cyclopropylmethyl)-9-phenylmethoxy-4a-(3-phenylprop-2-enoxy)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline |
|---|---|
| PubChem CID | 86621731 |
| Molecular Formula | C36H39NO3 |
| Molecular Weight | 533.71 g/mol |
| Exact Mass | 533.29 |
| IUPAC Name | (4R,4aS,7aS,12bS)-3-(cyclopropylmethyl)-9-phenylmethoxy-4a-(3-phenylprop-2-enoxy)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline |
| SMILES | C(=Cc1ccccc1)CO[C@@]12CCC[C@@H]3Oc4c(OCc5ccccc5)ccc5c4[C@@]31CCN(CC1CC1)[C@@H]2C5 |
| InChI | InChI=1S/C36H39NO3/c1-3-9-26(10-4-1)13-8-22-39-36-19-7-14-32-35(36)20-21-37(24-27-15-16-27)31(36)23-29-17-18-30(34(40-32)33(29)35)38-25-28-11-5-2-6-12-28/h1-6,8-13,17-18,27,31-32H,7,14-16,19-25H2/t31-,32+,35-,36-/m1/s1 |
| InChIKey | KIECQBYKPKHOJT-IKGCPKSMSA-N |
| XLogP | 6.96 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.71 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |