C30H35NO3 — CID 140529378
(4R,4aS,7aS,12bS)-3-cyclopropyl-11-methyl-9-phenylmethoxy-4a-prop-2-enoxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline (PubChem CID 140529378) has the molecular formula C30H35NO3 and a molecular weight of 457.61 g/mol. Its IUPAC name is (4R,4aS,7aS,12bS)-3-cyclopropyl-11-methyl-9-phenylmethoxy-4a-prop-2-enoxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline.
| Compound Name | (4R,4aS,7aS,12bS)-3-cyclopropyl-11-methyl-9-phenylmethoxy-4a-prop-2-enoxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline |
|---|---|
| PubChem CID | 140529378 |
| Molecular Formula | C30H35NO3 |
| Molecular Weight | 457.61 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | (4R,4aS,7aS,12bS)-3-cyclopropyl-11-methyl-9-phenylmethoxy-4a-prop-2-enoxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline |
| SMILES | C=CCO[C@@]12CCC[C@@H]3Oc4c(OCc5ccccc5)cc(C)c5c4[C@@]31CCN(C1CC1)[C@@H]2C5 |
| InChI | InChI=1S/C30H35NO3/c1-3-16-33-30-13-7-10-26-29(30)14-15-31(22-11-12-22)25(30)18-23-20(2)17-24(28(34-26)27(23)29)32-19-21-8-5-4-6-9-21/h3-6,8-9,17,22,25-26H,1,7,10-16,18-19H2,2H3/t25-,26+,29-,30-/m1/s1 |
| InChIKey | DKTHZKKACYRIEL-QUKNIHFLSA-N |
| XLogP | 5.49 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.61 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|