C28H33N2O3+ — CID 163669059
(1S)-16-(cyclopropylmethyl)-8-phenylmethoxy-6,19-dioxa-17-aza-16-azoniahexacyclo[9.8.2.01,13.05,13.07,12.016,20]henicosa-7,9,11-triene (PubChem CID 163669059) has the molecular formula C28H33N2O3+ and a molecular weight of 445.58 g/mol. Its IUPAC name is (1S)-16-(cyclopropylmethyl)-8-phenylmethoxy-6,19-dioxa-17-aza-16-azoniahexacyclo[9.8.2.01,13.05,13.07,12.016,20]henicosa-7,9,11-triene.
| Compound Name | (1S)-16-(cyclopropylmethyl)-8-phenylmethoxy-6,19-dioxa-17-aza-16-azoniahexacyclo[9.8.2.01,13.05,13.07,12.016,20]henicosa-7,9,11-triene |
|---|---|
| PubChem CID | 163669059 |
| Molecular Formula | C28H33N2O3+ |
| Molecular Weight | 445.58 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | (1S)-16-(cyclopropylmethyl)-8-phenylmethoxy-6,19-dioxa-17-aza-16-azoniahexacyclo[9.8.2.01,13.05,13.07,12.016,20]henicosa-7,9,11-triene |
| SMILES | c1ccc(COc2ccc3c4c2OC2CCC[C@]56OCN[N+](CC7CC7)(CCC425)C6C3)cc1 |
| InChI | InChI=1S/C28H33N2O3/c1-2-5-20(6-3-1)17-31-22-11-10-21-15-23-28-12-4-7-24-27(28,25(21)26(22)33-24)13-14-30(23,29-18-32-28)16-19-8-9-19/h1-3,5-6,10-11,19,23-24,29H,4,7-9,12-18H2/q+1/t23?,24?,27?,28-,30?/m1/s1 |
| InChIKey | WSTFKCRYJRGNTM-PLZAXJQXSA-N |
| XLogP | 4.23 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.58 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|