C29H34N2O3 — CID 67668834
(5R,10aS)-2-cyclohexyl-5-ethyl-8-phenylmethoxy-9-prop-2-enyl-10,10a-dihydro-5H-imidazo[1,5-b]isoquinoline-1,3-dione (PubChem CID 67668834) has the molecular formula C29H34N2O3 and a molecular weight of 458.60 g/mol. Its IUPAC name is (5R,10aS)-2-cyclohexyl-5-ethyl-8-phenylmethoxy-9-prop-2-enyl-10,10a-dihydro-5H-imidazo[1,5-b]isoquinoline-1,3-dione.
| Compound Name | (5R,10aS)-2-cyclohexyl-5-ethyl-8-phenylmethoxy-9-prop-2-enyl-10,10a-dihydro-5H-imidazo[1,5-b]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 67668834 |
| Molecular Formula | C29H34N2O3 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | (5R,10aS)-2-cyclohexyl-5-ethyl-8-phenylmethoxy-9-prop-2-enyl-10,10a-dihydro-5H-imidazo[1,5-b]isoquinoline-1,3-dione |
| SMILES | C=CCc1c(OCc2ccccc2)ccc2c1C[C@H]1C(=O)N(C3CCCCC3)C(=O)N1[C@@H]2CC |
| InChI | InChI=1S/C29H34N2O3/c1-3-11-23-24-18-26-28(32)30(21-14-9-6-10-15-21)29(33)31(26)25(4-2)22(24)16-17-27(23)34-19-20-12-7-5-8-13-20/h3,5,7-8,12-13,16-17,21,25-26H,1,4,6,9-11,14-15,18-19H2,2H3/t25-,26+/m1/s1 |
| InChIKey | UCVRTFXYFJGLGU-FTJBHMTQSA-N |
| XLogP | 5.97 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|