C27H29NO3S2 — CID 3511887
3-cyclohexyl-5-[(3-methoxy-4-phenylmethoxy-5-prop-2-enylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 3511887) has the molecular formula C27H29NO3S2 and a molecular weight of 479.67 g/mol. Its IUPAC name is 3-cyclohexyl-5-[(3-methoxy-4-phenylmethoxy-5-prop-2-enylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-cyclohexyl-5-[(3-methoxy-4-phenylmethoxy-5-prop-2-enylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3511887 |
| Molecular Formula | C27H29NO3S2 |
| Molecular Weight | 479.67 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 3-cyclohexyl-5-[(3-methoxy-4-phenylmethoxy-5-prop-2-enylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | C=CCc1cc(C=C2SC(=S)N(C3CCCCC3)C2=O)cc(OC)c1OCc1ccccc1 |
| InChI | InChI=1S/C27H29NO3S2/c1-3-10-21-15-20(16-23(30-2)25(21)31-18-19-11-6-4-7-12-19)17-24-26(29)28(27(32)33-24)22-13-8-5-9-14-22/h3-4,6-7,11-12,15-17,22H,1,5,8-10,13-14,18H2,2H3 |
| InChIKey | BXCOTABYNOIFES-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.67 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|