C16H18N4O5S2 — CID 86621997
N-[5-[2-[(1S,5S,7S)-7-(hydroxymethyl)-6,8-dioxa-3-azabicyclo[3.2.1]octane-3-carbonyl]-1,3-thiazol-4-yl]-4-methyl-1,3-thiazol-2-yl]acetamide (PubChem CID 86621997) has the molecular formula C16H18N4O5S2 and a molecular weight of 410.48 g/mol. Its IUPAC name is N-[5-[2-[(1S,5S,7S)-7-(hydroxymethyl)-6,8-dioxa-3-azabicyclo[3.2.1]octane-3-carbonyl]-1,3-thiazol-4-yl]-4-methyl-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[5-[2-[(1S,5S,7S)-7-(hydroxymethyl)-6,8-dioxa-3-azabicyclo[3.2.1]octane-3-carbonyl]-1,3-thiazol-4-yl]-4-methyl-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 86621997 |
| Molecular Formula | C16H18N4O5S2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | N-[5-[2-[(1S,5S,7S)-7-(hydroxymethyl)-6,8-dioxa-3-azabicyclo[3.2.1]octane-3-carbonyl]-1,3-thiazol-4-yl]-4-methyl-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc(C)c(-c2csc(C(=O)N3C[C@@H]4O[C@@H](CO)[C@H](C3)O4)n2)s1 |
| InChI | InChI=1S/C16H18N4O5S2/c1-7-13(27-16(17-7)18-8(2)22)9-6-26-14(19-9)15(23)20-3-10-11(5-21)25-12(4-20)24-10/h6,10-12,21H,3-5H2,1-2H3,(H,17,18,22)/t10-,11-,12-/m0/s1 |
| InChIKey | GGKBSEOZJLEFDM-SRVKXCTJSA-N |
| XLogP | 1.09 |
| TPSA | 113.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |