C20H26ClN3O4 — CID 86622302
tert-butyl (2R)-2-[(4-chloro-7-ethoxyquinazolin-5-yl)oxymethyl]pyrrolidine-1-carboxylate (PubChem CID 86622302) has the molecular formula C20H26ClN3O4 and a molecular weight of 407.90 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(4-chloro-7-ethoxyquinazolin-5-yl)oxymethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[(4-chloro-7-ethoxyquinazolin-5-yl)oxymethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 86622302 |
| Molecular Formula | C20H26ClN3O4 |
| Molecular Weight | 407.90 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | tert-butyl (2R)-2-[(4-chloro-7-ethoxyquinazolin-5-yl)oxymethyl]pyrrolidine-1-carboxylate |
| SMILES | CCOc1cc(OC[C@H]2CCCN2C(=O)OC(C)(C)C)c2c(Cl)ncnc2c1 |
| InChI | InChI=1S/C20H26ClN3O4/c1-5-26-14-9-15-17(18(21)23-12-22-15)16(10-14)27-11-13-7-6-8-24(13)19(25)28-20(2,3)4/h9-10,12-13H,5-8,11H2,1-4H3/t13-/m1/s1 |
| InChIKey | XXADCRXKLAAHGL-CYBMUJFWSA-N |
| XLogP | 4.46 |
| TPSA | 73.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.90 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |