C21H17N3O4 — CID 8662949
[2-(2-methyl-1H-indol-3-yl)-2-oxoethyl] 4-[(2-cyanoacetyl)amino]benzoate (PubChem CID 8662949) has the molecular formula C21H17N3O4 and a molecular weight of 375.38 g/mol. Its IUPAC name is [2-(2-methyl-1H-indol-3-yl)-2-oxoethyl] 4-[(2-cyanoacetyl)amino]benzoate.
| Compound Name | [2-(2-methyl-1H-indol-3-yl)-2-oxoethyl] 4-[(2-cyanoacetyl)amino]benzoate |
|---|---|
| PubChem CID | 8662949 |
| Molecular Formula | C21H17N3O4 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | [2-(2-methyl-1H-indol-3-yl)-2-oxoethyl] 4-[(2-cyanoacetyl)amino]benzoate |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)COC(=O)c1ccc(NC(=O)CC#N)cc1 |
| InChI | InChI=1S/C21H17N3O4/c1-13-20(16-4-2-3-5-17(16)23-13)18(25)12-28-21(27)14-6-8-15(9-7-14)24-19(26)10-11-22/h2-9,23H,10,12H2,1H3,(H,24,26) |
| InChIKey | FEXPZWAIEHQBQN-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |