C13H13FN2O8 — CID 86629740
4-O-ethyl 1-O-methyl 2-(4-fluoro-2,6-dinitrophenyl)butanedioate (PubChem CID 86629740) has the molecular formula C13H13FN2O8 and a molecular weight of 344.25 g/mol. Its IUPAC name is 4-O-ethyl 1-O-methyl 2-(4-fluoro-2,6-dinitrophenyl)butanedioate.
| Compound Name | 4-O-ethyl 1-O-methyl 2-(4-fluoro-2,6-dinitrophenyl)butanedioate |
|---|---|
| PubChem CID | 86629740 |
| Molecular Formula | C13H13FN2O8 |
| Molecular Weight | 344.25 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 4-O-ethyl 1-O-methyl 2-(4-fluoro-2,6-dinitrophenyl)butanedioate |
| SMILES | CCOC(=O)CC(C(=O)OC)c1c([N+](=O)[O-])cc(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H13FN2O8/c1-3-24-11(17)6-8(13(18)23-2)12-9(15(19)20)4-7(14)5-10(12)16(21)22/h4-5,8H,3,6H2,1-2H3 |
| InChIKey | BDOZMSBGVLKCGE-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 138.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.25 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|