C15H11ClN2O2S — CID 86630125
6-chloro-4-(4-nitrophenyl)-3,4-dihydro-2H-isoquinoline-1-thione (PubChem CID 86630125) has the molecular formula C15H11ClN2O2S and a molecular weight of 318.79 g/mol. Its IUPAC name is 6-chloro-4-(4-nitrophenyl)-3,4-dihydro-2H-isoquinoline-1-thione.
| Compound Name | 6-chloro-4-(4-nitrophenyl)-3,4-dihydro-2H-isoquinoline-1-thione |
|---|---|
| PubChem CID | 86630125 |
| Molecular Formula | C15H11ClN2O2S |
| Molecular Weight | 318.79 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | 6-chloro-4-(4-nitrophenyl)-3,4-dihydro-2H-isoquinoline-1-thione |
| SMILES | O=[N+]([O-])c1ccc(C2CNC(=S)c3ccc(Cl)cc32)cc1 |
| InChI | InChI=1S/C15H11ClN2O2S/c16-10-3-6-12-13(7-10)14(8-17-15(12)21)9-1-4-11(5-2-9)18(19)20/h1-7,14H,8H2,(H,17,21) |
| InChIKey | GHXXKCDWGWGQJC-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.79 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|