C22H24O5 — CID 8663429
[2-[4-[(2S)-butan-2-yl]phenyl]-2-oxoethyl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate (PubChem CID 8663429) has the molecular formula C22H24O5 and a molecular weight of 368.43 g/mol. Its IUPAC name is [2-[4-[(2S)-butan-2-yl]phenyl]-2-oxoethyl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate.
| Compound Name | [2-[4-[(2S)-butan-2-yl]phenyl]-2-oxoethyl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8663429 |
| Molecular Formula | C22H24O5 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | [2-[4-[(2S)-butan-2-yl]phenyl]-2-oxoethyl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| SMILES | CC[C@H](C)c1ccc(C(=O)COC(=O)/C=C/c2ccc(O)c(OC)c2)cc1 |
| InChI | InChI=1S/C22H24O5/c1-4-15(2)17-7-9-18(10-8-17)20(24)14-27-22(25)12-6-16-5-11-19(23)21(13-16)26-3/h5-13,15,23H,4,14H2,1-3H3/b12-6+/t15-/m0/s1 |
| InChIKey | MLSWYOMVZMUTOK-MFMIUCCHSA-N |
| XLogP | 4.35 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|