About ethyl 2-(N-amino-4-chloroanilino)acetate;phenylhydrazine
ethyl 2-(N-amino-4-chloroanilino)acetate;phenylhydrazine (PubChem CID 86635498) has the molecular formula C16H21ClN4O2
and a molecular weight of 336.82 g/mol. Its IUPAC name is ethyl 2-(N-amino-4-chloroanilino)acetate;phenylhydrazine.
Molecular Properties
| Compound Name | ethyl 2-(N-amino-4-chloroanilino)acetate;phenylhydrazine |
| PubChem CID | 86635498 |
| Molecular Formula | C16H21ClN4O2 |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | ethyl 2-(N-amino-4-chloroanilino)acetate;phenylhydrazine |
| SMILES | CCOC(=O)CN(N)c1ccc(Cl)cc1.NNc1ccccc1 |
| InChI | InChI=1S/C10H13ClN2O2.C6H8N2/c1-2-15-10(14)7-13(12)9-5-3-8(11)4-6-9;7-8-6-4-2-1-3-5-6/h3-6H,2,7,12H2,1H3;1-5,8H,7H2 |
| InChIKey | CVDZRUSZIMFZQX-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-(N-amino-4-chloroanilino)acetate;phenylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(N-amino-4-chloroanilino)acetate;phenylhydrazine?
The IUPAC name of ethyl 2-(N-amino-4-chloroanilino)acetate;phenylhydrazine (CID 86635498) is ethyl 2-(N-amino-4-chloroanilino)acetate;phenylhydrazine.
What is the SMILES notation for ethyl 2-(N-amino-4-chloroanilino)acetate;phenylhydrazine?
The canonical SMILES for ethyl 2-(N-amino-4-chloroanilino)acetate;phenylhydrazine is CCOC(=O)CN(N)c1ccc(Cl)cc1.NNc1ccccc1.
What is the InChIKey of ethyl 2-(N-amino-4-chloroanilino)acetate;phenylhydrazine?
The InChIKey is CVDZRUSZIMFZQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13ClN2O2.C6H8N2/c1-2-15-10(14)7-13(12)9-5-3-8(11)4-6-9;7-8-6-4-2-1-3-5-6/h3-6H,2,7,12H2,1H3;1-5,8H,7H2.
What are the key properties of ethyl 2-(N-amino-4-chloroanilino)acetate;phenylhydrazine?
ethyl 2-(N-amino-4-chloroanilino)acetate;phenylhydrazine has a molecular weight of 336.82 g/mol, XLogP of 2.56, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(N-amino-4-chloroanilino)acetate;phenylhydrazine is sourced from PubChem (CID 86635498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).