acetic acid;(4-chlorophenyl)hydrazine

C8H11ClN2O2 — CID 172727373

IUPACacetic acid;(4-chlorophenyl)hydrazine
SMILESCC(=O)O.NNc1ccc(Cl)cc1
InChIInChI=1S/C6H7ClN2.C2H4O2/c7-5-1-3-6(9-8)4-2-5;1-2(3)4/h1-4,9H,8H2;1H3,(H,3,4)
InChIKeyHICRJATXYQKHDP-UHFFFAOYSA-N
MW202.64 g/mol
LogP1.72
Rot. Bonds1

About acetic acid;(4-chlorophenyl)hydrazine

acetic acid;(4-chlorophenyl)hydrazine (PubChem CID 172727373) has the molecular formula C8H11ClN2O2 and a molecular weight of 202.64 g/mol. Its IUPAC name is acetic acid;(4-chlorophenyl)hydrazine.

Molecular Properties

Compound Nameacetic acid;(4-chlorophenyl)hydrazine
PubChem CID172727373
Molecular FormulaC8H11ClN2O2
Molecular Weight202.64 g/mol
Exact Mass202.05
IUPAC Nameacetic acid;(4-chlorophenyl)hydrazine
SMILESCC(=O)O.NNc1ccc(Cl)cc1
InChIInChI=1S/C6H7ClN2.C2H4O2/c7-5-1-3-6(9-8)4-2-5;1-2(3)4/h1-4,9H,8H2;1H3,(H,3,4)
InChIKeyHICRJATXYQKHDP-UHFFFAOYSA-N
XLogP1.72
TPSA75.35 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500202.64
LogP ≤ 51.72
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze acetic acid;(4-chlorophenyl)hydrazine with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;(4-chlorophenyl)hydrazine?
The IUPAC name of acetic acid;(4-chlorophenyl)hydrazine (CID 172727373) is acetic acid;(4-chlorophenyl)hydrazine.
What is the SMILES notation for acetic acid;(4-chlorophenyl)hydrazine?
The canonical SMILES for acetic acid;(4-chlorophenyl)hydrazine is CC(=O)O.NNc1ccc(Cl)cc1.
What is the InChIKey of acetic acid;(4-chlorophenyl)hydrazine?
The InChIKey is HICRJATXYQKHDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7ClN2.C2H4O2/c7-5-1-3-6(9-8)4-2-5;1-2(3)4/h1-4,9H,8H2;1H3,(H,3,4).
What are the key properties of acetic acid;(4-chlorophenyl)hydrazine?
acetic acid;(4-chlorophenyl)hydrazine has a molecular weight of 202.64 g/mol, XLogP of 1.72, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;(4-chlorophenyl)hydrazine is sourced from PubChem (CID 172727373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).