About lithium;tert-butylbenzene;oxolane
lithium;tert-butylbenzene;oxolane (PubChem CID 86638313) has the molecular formula C14H21LiO
and a molecular weight of 212.26 g/mol. Its IUPAC name is lithium;tert-butylbenzene;oxolane.
Molecular Properties
| Compound Name | lithium;tert-butylbenzene;oxolane |
| PubChem CID | 86638313 |
| Molecular Formula | C14H21LiO |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | lithium;tert-butylbenzene;oxolane |
| SMILES | C1CCOC1.CC(C)(C)c1cc[c-]cc1.[Li+] |
| InChI | InChI=1S/C10H13.C4H8O.Li/c1-10(2,3)9-7-5-4-6-8-9;1-2-4-5-3-1;/h5-8H,1-3H3;1-4H2;/q-1;;+1 |
| InChIKey | ZDPYCVDJBZPCJX-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze lithium;tert-butylbenzene;oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;tert-butylbenzene;oxolane?
The IUPAC name of lithium;tert-butylbenzene;oxolane (CID 86638313) is lithium;tert-butylbenzene;oxolane.
What is the SMILES notation for lithium;tert-butylbenzene;oxolane?
The canonical SMILES for lithium;tert-butylbenzene;oxolane is C1CCOC1.CC(C)(C)c1cc[c-]cc1.[Li+].
What is the InChIKey of lithium;tert-butylbenzene;oxolane?
The InChIKey is ZDPYCVDJBZPCJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13.C4H8O.Li/c1-10(2,3)9-7-5-4-6-8-9;1-2-4-5-3-1;/h5-8H,1-3H3;1-4H2;/q-1;;+1.
What are the key properties of lithium;tert-butylbenzene;oxolane?
lithium;tert-butylbenzene;oxolane has a molecular weight of 212.26 g/mol, XLogP of 0.59, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;tert-butylbenzene;oxolane is sourced from PubChem (CID 86638313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).