C15H17F3N2O2 — CID 86638388
3-[7-oxo-4-[3-(trifluoromethyl)phenyl]-1,4-diazepan-1-yl]propanal (PubChem CID 86638388) has the molecular formula C15H17F3N2O2 and a molecular weight of 314.31 g/mol. Its IUPAC name is 3-[7-oxo-4-[3-(trifluoromethyl)phenyl]-1,4-diazepan-1-yl]propanal.
| Compound Name | 3-[7-oxo-4-[3-(trifluoromethyl)phenyl]-1,4-diazepan-1-yl]propanal |
|---|---|
| PubChem CID | 86638388 |
| Molecular Formula | C15H17F3N2O2 |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 3-[7-oxo-4-[3-(trifluoromethyl)phenyl]-1,4-diazepan-1-yl]propanal |
| SMILES | O=CCCN1CCN(c2cccc(C(F)(F)F)c2)CCC1=O |
| InChI | InChI=1S/C15H17F3N2O2/c16-15(17,18)12-3-1-4-13(11-12)19-7-5-14(22)20(9-8-19)6-2-10-21/h1,3-4,10-11H,2,5-9H2 |
| InChIKey | DQBCRCGGOIVGAZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|