C15H21ClN2O4 — CID 86639450
benzyl N-[(2R)-1-(4-chlorobutanoylamino)-3-hydroxypropan-2-yl]carbamate (PubChem CID 86639450) has the molecular formula C15H21ClN2O4 and a molecular weight of 328.80 g/mol. Its IUPAC name is benzyl N-[(2R)-1-(4-chlorobutanoylamino)-3-hydroxypropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2R)-1-(4-chlorobutanoylamino)-3-hydroxypropan-2-yl]carbamate |
|---|---|
| PubChem CID | 86639450 |
| Molecular Formula | C15H21ClN2O4 |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | benzyl N-[(2R)-1-(4-chlorobutanoylamino)-3-hydroxypropan-2-yl]carbamate |
| SMILES | O=C(CCCCl)NC[C@H](CO)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H21ClN2O4/c16-8-4-7-14(20)17-9-13(10-19)18-15(21)22-11-12-5-2-1-3-6-12/h1-3,5-6,13,19H,4,7-11H2,(H,17,20)(H,18,21)/t13-/m1/s1 |
| InChIKey | AHFCCVIUJRMYEJ-CYBMUJFWSA-N |
| XLogP | 1.41 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|