C24H19ClN4O2 — CID 86640840
1-[[3-(6-chloro-3-pyridinyl)-1,2,4-oxadiazol-5-yl]methyl]-3,3-diphenylpyrrolidin-2-one (PubChem CID 86640840) has the molecular formula C24H19ClN4O2 and a molecular weight of 430.90 g/mol. Its IUPAC name is 1-[[3-(6-chloro-3-pyridinyl)-1,2,4-oxadiazol-5-yl]methyl]-3,3-diphenylpyrrolidin-2-one.
| Compound Name | 1-[[3-(6-chloro-3-pyridinyl)-1,2,4-oxadiazol-5-yl]methyl]-3,3-diphenylpyrrolidin-2-one |
|---|---|
| PubChem CID | 86640840 |
| Molecular Formula | C24H19ClN4O2 |
| Molecular Weight | 430.90 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 1-[[3-(6-chloro-3-pyridinyl)-1,2,4-oxadiazol-5-yl]methyl]-3,3-diphenylpyrrolidin-2-one |
| SMILES | O=C1N(Cc2nc(-c3ccc(Cl)nc3)no2)CCC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H19ClN4O2/c25-20-12-11-17(15-26-20)22-27-21(31-28-22)16-29-14-13-24(23(29)30,18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1-12,15H,13-14,16H2 |
| InChIKey | TVIVSMKKYUTXCY-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 72.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.90 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|