C28H41NO6SSi — CID 86640979
tert-butyl (2S,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methylsulfonyloxypiperidine-1-carboxylate (PubChem CID 86640979) has the molecular formula C28H41NO6SSi and a molecular weight of 547.79 g/mol. Its IUPAC name is tert-butyl (2S,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methylsulfonyloxypiperidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methylsulfonyloxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 86640979 |
| Molecular Formula | C28H41NO6SSi |
| Molecular Weight | 547.79 g/mol |
| Exact Mass | 547.24 |
| IUPAC Name | tert-butyl (2S,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methylsulfonyloxypiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](OS(C)(=O)=O)C[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H41NO6SSi/c1-27(2,3)34-26(30)29-19-18-23(35-36(7,31)32)20-22(29)21-33-37(28(4,5)6,24-14-10-8-11-15-24)25-16-12-9-13-17-25/h8-17,22-23H,18-21H2,1-7H3/t22-,23+/m0/s1 |
| InChIKey | YTCAXCXEXVDXGO-XZOQPEGZSA-N |
| XLogP | 4.31 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.79 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|