C18H14NO4+ — CID 86641625
8-methyl-1,6-dihydroisoquinolino[2,1-b]isoquinolin-1-ylium-2,3,10,11-tetrol (PubChem CID 86641625) has the molecular formula C18H14NO4+ and a molecular weight of 308.31 g/mol. Its IUPAC name is 8-methyl-1,6-dihydroisoquinolino[2,1-b]isoquinolin-1-ylium-2,3,10,11-tetrol.
| Compound Name | 8-methyl-1,6-dihydroisoquinolino[2,1-b]isoquinolin-1-ylium-2,3,10,11-tetrol |
|---|---|
| PubChem CID | 86641625 |
| Molecular Formula | C18H14NO4+ |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 8-methyl-1,6-dihydroisoquinolino[2,1-b]isoquinolin-1-ylium-2,3,10,11-tetrol |
| SMILES | CC1=c2cc(O)c(O)cc2=CC2=C3[C+]=C(O)C(O)=CC3=CCN21 |
| InChI | InChI=1S/C18H13NO4/c1-9-12-7-17(22)16(21)6-11(12)4-14-13-8-18(23)15(20)5-10(13)2-3-19(9)14/h2,4-7H,3H2,1H3,(H3-,20,21,22,23)/p+1 |
| InChIKey | ARYNUCSLWHKOBS-UHFFFAOYSA-O |
| XLogP | 1.22 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|