C10H11NO — CID 86650780
N-[(1R,2S)-2-phenylcyclopropyl]formamide (PubChem CID 86650780) has the molecular formula C10H11NO and a molecular weight of 161.20 g/mol. Its IUPAC name is N-[(1R,2S)-2-phenylcyclopropyl]formamide.
| Compound Name | N-[(1R,2S)-2-phenylcyclopropyl]formamide |
|---|---|
| PubChem CID | 86650780 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | N-[(1R,2S)-2-phenylcyclopropyl]formamide |
| SMILES | O=CN[C@@H]1C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C10H11NO/c12-7-11-10-6-9(10)8-4-2-1-3-5-8/h1-5,7,9-10H,6H2,(H,11,12)/t9-,10+/m0/s1 |
| InChIKey | CZPSDBJHVTYMBQ-VHSXEESVSA-N |
| XLogP | 1.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|