C14H21BrO3 — CID 86650814
2-bromo-6-tert-butyl-4-(1,1-dimethoxyethyl)phenol (PubChem CID 86650814) has the molecular formula C14H21BrO3 and a molecular weight of 317.22 g/mol. Its IUPAC name is 2-bromo-6-tert-butyl-4-(1,1-dimethoxyethyl)phenol.
| Compound Name | 2-bromo-6-tert-butyl-4-(1,1-dimethoxyethyl)phenol |
|---|---|
| PubChem CID | 86650814 |
| Molecular Formula | C14H21BrO3 |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 2-bromo-6-tert-butyl-4-(1,1-dimethoxyethyl)phenol |
| SMILES | COC(C)(OC)c1cc(Br)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C14H21BrO3/c1-13(2,3)10-7-9(8-11(15)12(10)16)14(4,17-5)18-6/h7-8,16H,1-6H3 |
| InChIKey | JFURJSAEBUNAIZ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|