C16H13ClN2O — CID 86652367
1-[(4-chloro-2-methylphenyl)methyl]indazole-3-carbaldehyde (PubChem CID 86652367) has the molecular formula C16H13ClN2O and a molecular weight of 284.75 g/mol. Its IUPAC name is 1-[(4-chloro-2-methylphenyl)methyl]indazole-3-carbaldehyde.
| Compound Name | 1-[(4-chloro-2-methylphenyl)methyl]indazole-3-carbaldehyde |
|---|---|
| PubChem CID | 86652367 |
| Molecular Formula | C16H13ClN2O |
| Molecular Weight | 284.75 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 1-[(4-chloro-2-methylphenyl)methyl]indazole-3-carbaldehyde |
| SMILES | Cc1cc(Cl)ccc1Cn1nc(C=O)c2ccccc21 |
| InChI | InChI=1S/C16H13ClN2O/c1-11-8-13(17)7-6-12(11)9-19-16-5-3-2-4-14(16)15(10-20)18-19/h2-8,10H,9H2,1H3 |
| InChIKey | ARSJOSRUPLZMCP-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.75 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|