C19H17ClN2O4S — CID 69405368
(E)-3-[1-[(4-chloro-2-methylphenyl)methyl]-6-methylsulfonylindazol-3-yl]prop-2-enoic acid (PubChem CID 69405368) has the molecular formula C19H17ClN2O4S and a molecular weight of 404.88 g/mol. Its IUPAC name is (E)-3-[1-[(4-chloro-2-methylphenyl)methyl]-6-methylsulfonylindazol-3-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[1-[(4-chloro-2-methylphenyl)methyl]-6-methylsulfonylindazol-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 69405368 |
| Molecular Formula | C19H17ClN2O4S |
| Molecular Weight | 404.88 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | (E)-3-[1-[(4-chloro-2-methylphenyl)methyl]-6-methylsulfonylindazol-3-yl]prop-2-enoic acid |
| SMILES | Cc1cc(Cl)ccc1Cn1nc(/C=C/C(=O)O)c2ccc(S(C)(=O)=O)cc21 |
| InChI | InChI=1S/C19H17ClN2O4S/c1-12-9-14(20)4-3-13(12)11-22-18-10-15(27(2,25)26)5-6-16(18)17(21-22)7-8-19(23)24/h3-10H,11H2,1-2H3,(H,23,24)/b8-7+ |
| InChIKey | UNCBLPOPEWWJQP-BQYQJAHWSA-N |
| XLogP | 3.55 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.88 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|