C30H33F4N3O6S — CID 86653341
tert-butyl 2-[[1-(4-fluorophenyl)-4-methylpiperidin-4-yl]methyl]-5-phenylmethoxy-6-(trifluoromethylsulfonyloxy)pyrimidine-4-carboxylate (PubChem CID 86653341) has the molecular formula C30H33F4N3O6S and a molecular weight of 639.67 g/mol. Its IUPAC name is tert-butyl 2-[[1-(4-fluorophenyl)-4-methylpiperidin-4-yl]methyl]-5-phenylmethoxy-6-(trifluoromethylsulfonyloxy)pyrimidine-4-carboxylate.
| Compound Name | tert-butyl 2-[[1-(4-fluorophenyl)-4-methylpiperidin-4-yl]methyl]-5-phenylmethoxy-6-(trifluoromethylsulfonyloxy)pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 86653341 |
| Molecular Formula | C30H33F4N3O6S |
| Molecular Weight | 639.67 g/mol |
| Exact Mass | 639.20 |
| IUPAC Name | tert-butyl 2-[[1-(4-fluorophenyl)-4-methylpiperidin-4-yl]methyl]-5-phenylmethoxy-6-(trifluoromethylsulfonyloxy)pyrimidine-4-carboxylate |
| SMILES | CC1(Cc2nc(OS(=O)(=O)C(F)(F)F)c(OCc3ccccc3)c(C(=O)OC(C)(C)C)n2)CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C30H33F4N3O6S/c1-28(2,3)42-27(38)24-25(41-19-20-8-6-5-7-9-20)26(43-44(39,40)30(32,33)34)36-23(35-24)18-29(4)14-16-37(17-15-29)22-12-10-21(31)11-13-22/h5-13H,14-19H2,1-4H3 |
| InChIKey | OHBOXEZQWRYRGV-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 107.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.67 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|