C18H25F3N4O7S2 — CID 86657082
tert-butyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)-4-(trifluoromethylsulfonyloxy)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-7-carboxylate (PubChem CID 86657082) has the molecular formula C18H25F3N4O7S2 and a molecular weight of 530.55 g/mol. Its IUPAC name is tert-butyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)-4-(trifluoromethylsulfonyloxy)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-7-carboxylate.
| Compound Name | tert-butyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)-4-(trifluoromethylsulfonyloxy)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-7-carboxylate |
|---|---|
| PubChem CID | 86657082 |
| Molecular Formula | C18H25F3N4O7S2 |
| Molecular Weight | 530.55 g/mol |
| Exact Mass | 530.11 |
| IUPAC Name | tert-butyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)-4-(trifluoromethylsulfonyloxy)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2nc(N3CCS(=O)(=O)CC3)nc(OS(=O)(=O)C(F)(F)F)c2CC1 |
| InChI | InChI=1S/C18H25F3N4O7S2/c1-17(2,3)31-16(26)25-6-4-12-13(5-7-25)22-15(24-8-10-33(27,28)11-9-24)23-14(12)32-34(29,30)18(19,20)21/h4-11H2,1-3H3 |
| InChIKey | RPWVXAHXTGJYQG-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 136.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.55 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|