C13H21NO4 — CID 86657748
ethyl 2-[(7S,8aR)-1,1-dimethyl-3-oxo-6,7,8,8a-tetrahydro-5H-[1,3]oxazolo[3,4-a]pyridin-7-yl]acetate (PubChem CID 86657748) has the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. Its IUPAC name is ethyl 2-[(7S,8aR)-1,1-dimethyl-3-oxo-6,7,8,8a-tetrahydro-5H-[1,3]oxazolo[3,4-a]pyridin-7-yl]acetate.
| Compound Name | ethyl 2-[(7S,8aR)-1,1-dimethyl-3-oxo-6,7,8,8a-tetrahydro-5H-[1,3]oxazolo[3,4-a]pyridin-7-yl]acetate |
|---|---|
| PubChem CID | 86657748 |
| Molecular Formula | C13H21NO4 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | ethyl 2-[(7S,8aR)-1,1-dimethyl-3-oxo-6,7,8,8a-tetrahydro-5H-[1,3]oxazolo[3,4-a]pyridin-7-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1CCN2C(=O)OC(C)(C)[C@H]2C1 |
| InChI | InChI=1S/C13H21NO4/c1-4-17-11(15)8-9-5-6-14-10(7-9)13(2,3)18-12(14)16/h9-10H,4-8H2,1-3H3/t9-,10+/m0/s1 |
| InChIKey | MBKSUSOYNZEEFZ-VHSXEESVSA-N |
| XLogP | 1.95 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |