C6H11ClF2NO- — CID 86657793
(4,4-difluoropiperidin-3-yl)methanol chloride (PubChem CID 86657793) has the molecular formula C6H11ClF2NO- and a molecular weight of 186.61 g/mol. Its IUPAC name is (4,4-difluoropiperidin-3-yl)methanol chloride.
| Compound Name | (4,4-difluoropiperidin-3-yl)methanol chloride |
|---|---|
| PubChem CID | 86657793 |
| Molecular Formula | C6H11ClF2NO- |
| Molecular Weight | 186.61 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | (4,4-difluoropiperidin-3-yl)methanol chloride |
| SMILES | OCC1CNCCC1(F)F.[Cl-] |
| InChI | InChI=1S/C6H11F2NO.ClH/c7-6(8)1-2-9-3-5(6)4-10;/h5,9-10H,1-4H2;1H/p-1 |
| InChIKey | FZLKYPPNCKYROE-UHFFFAOYSA-M |
| XLogP | -2.77 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.61 |
| LogP ≤ 5 | -2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |