C10H9N3O3 — CID 86657865
phenyl N-(5-methyl-1,3,4-oxadiazol-2-yl)carbamate (PubChem CID 86657865) has the molecular formula C10H9N3O3 and a molecular weight of 219.20 g/mol. Its IUPAC name is phenyl N-(5-methyl-1,3,4-oxadiazol-2-yl)carbamate.
| Compound Name | phenyl N-(5-methyl-1,3,4-oxadiazol-2-yl)carbamate |
|---|---|
| PubChem CID | 86657865 |
| Molecular Formula | C10H9N3O3 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | phenyl N-(5-methyl-1,3,4-oxadiazol-2-yl)carbamate |
| SMILES | Cc1nnc(NC(=O)Oc2ccccc2)o1 |
| InChI | InChI=1S/C10H9N3O3/c1-7-12-13-9(15-7)11-10(14)16-8-5-3-2-4-6-8/h2-6H,1H3,(H,11,13,14) |
| InChIKey | AFHTZPSEJVSXGV-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |