About [3,3-dimethyl-1-(pyridin-3-ylmethyl)-2H-indol-5-yl] N-(cyclohexylmethyl)carbamate
[3,3-dimethyl-1-(pyridin-3-ylmethyl)-2H-indol-5-yl] N-(cyclohexylmethyl)carbamate (PubChem CID 86659899) has the molecular formula C24H31N3O2
and a molecular weight of 393.53 g/mol. Its IUPAC name is [3,3-dimethyl-1-(pyridin-3-ylmethyl)-2H-indol-5-yl] N-(cyclohexylmethyl)carbamate.
Molecular Properties
| Compound Name | [3,3-dimethyl-1-(pyridin-3-ylmethyl)-2H-indol-5-yl] N-(cyclohexylmethyl)carbamate |
| PubChem CID | 86659899 |
| Molecular Formula | C24H31N3O2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | [3,3-dimethyl-1-(pyridin-3-ylmethyl)-2H-indol-5-yl] N-(cyclohexylmethyl)carbamate |
| SMILES | CC1(C)CN(Cc2cccnc2)c2ccc(OC(=O)NCC3CCCCC3)cc21 |
| InChI | InChI=1S/C24H31N3O2/c1-24(2)17-27(16-19-9-6-12-25-14-19)22-11-10-20(13-21(22)24)29-23(28)26-15-18-7-4-3-5-8-18/h6,9-14,18H,3-5,7-8,15-17H2,1-2H3,(H,26,28) |
| InChIKey | YHOYNKCXQVLTOF-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3,3-dimethyl-1-(pyridin-3-ylmethyl)-2H-indol-5-yl] N-(cyclohexylmethyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,3-dimethyl-1-(pyridin-3-ylmethyl)-2H-indol-5-yl] N-(cyclohexylmethyl)carbamate?
The IUPAC name of [3,3-dimethyl-1-(pyridin-3-ylmethyl)-2H-indol-5-yl] N-(cyclohexylmethyl)carbamate (CID 86659899) is [3,3-dimethyl-1-(pyridin-3-ylmethyl)-2H-indol-5-yl] N-(cyclohexylmethyl)carbamate.
What is the SMILES notation for [3,3-dimethyl-1-(pyridin-3-ylmethyl)-2H-indol-5-yl] N-(cyclohexylmethyl)carbamate?
The canonical SMILES for [3,3-dimethyl-1-(pyridin-3-ylmethyl)-2H-indol-5-yl] N-(cyclohexylmethyl)carbamate is CC1(C)CN(Cc2cccnc2)c2ccc(OC(=O)NCC3CCCCC3)cc21.
What is the InChIKey of [3,3-dimethyl-1-(pyridin-3-ylmethyl)-2H-indol-5-yl] N-(cyclohexylmethyl)carbamate?
The InChIKey is YHOYNKCXQVLTOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H31N3O2/c1-24(2)17-27(16-19-9-6-12-25-14-19)22-11-10-20(13-21(22)24)29-23(28)26-15-18-7-4-3-5-8-18/h6,9-14,18H,3-5,7-8,15-17H2,1-2H3,(H,26,28).
What are the key properties of [3,3-dimethyl-1-(pyridin-3-ylmethyl)-2H-indol-5-yl] N-(cyclohexylmethyl)carbamate?
[3,3-dimethyl-1-(pyridin-3-ylmethyl)-2H-indol-5-yl] N-(cyclohexylmethyl)carbamate has a molecular weight of 393.53 g/mol, XLogP of 5.05, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3,3-dimethyl-1-(pyridin-3-ylmethyl)-2H-indol-5-yl] N-(cyclohexylmethyl)carbamate is sourced from PubChem (CID 86659899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).