C15H25NO3 — CID 86661264
[1-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]-1-oxopropan-2-yl] acetate (PubChem CID 86661264) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is [1-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]-1-oxopropan-2-yl] acetate.
| Compound Name | [1-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]-1-oxopropan-2-yl] acetate |
|---|---|
| PubChem CID | 86661264 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | [1-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]-1-oxopropan-2-yl] acetate |
| SMILES | CC(=O)OC(C)C(=O)NC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C15H25NO3/c1-11(2)7-6-8-12(3)9-10-16-15(18)13(4)19-14(5)17/h7,9,13H,6,8,10H2,1-5H3,(H,16,18)/b12-9+ |
| InChIKey | LGQRCFBEWUVBAT-FMIVXFBMSA-N |
| XLogP | 2.75 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|