C19H19N5O4S — CID 86661489
2-[4-[5-amino-6-(pyridin-3-ylcarbamoyl)pyrazin-2-yl]phenyl]ethyl methanesulfonate (PubChem CID 86661489) has the molecular formula C19H19N5O4S and a molecular weight of 413.46 g/mol. Its IUPAC name is 2-[4-[5-amino-6-(pyridin-3-ylcarbamoyl)pyrazin-2-yl]phenyl]ethyl methanesulfonate.
| Compound Name | 2-[4-[5-amino-6-(pyridin-3-ylcarbamoyl)pyrazin-2-yl]phenyl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 86661489 |
| Molecular Formula | C19H19N5O4S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 2-[4-[5-amino-6-(pyridin-3-ylcarbamoyl)pyrazin-2-yl]phenyl]ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCc1ccc(-c2cnc(N)c(C(=O)Nc3cccnc3)n2)cc1 |
| InChI | InChI=1S/C19H19N5O4S/c1-29(26,27)28-10-8-13-4-6-14(7-5-13)16-12-22-18(20)17(24-16)19(25)23-15-3-2-9-21-11-15/h2-7,9,11-12H,8,10H2,1H3,(H2,20,22)(H,23,25) |
| InChIKey | ITMYUZSYKNXQBX-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 137.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|