C23H27N5O2 — CID 141307212
6-[4-[3-(3-methoxypropylamino)propyl]phenyl]-N-pyridin-3-ylpyrazine-2-carboxamide (PubChem CID 141307212) has the molecular formula C23H27N5O2 and a molecular weight of 405.50 g/mol. Its IUPAC name is 6-[4-[3-(3-methoxypropylamino)propyl]phenyl]-N-pyridin-3-ylpyrazine-2-carboxamide.
| Compound Name | 6-[4-[3-(3-methoxypropylamino)propyl]phenyl]-N-pyridin-3-ylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 141307212 |
| Molecular Formula | C23H27N5O2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | 6-[4-[3-(3-methoxypropylamino)propyl]phenyl]-N-pyridin-3-ylpyrazine-2-carboxamide |
| SMILES | COCCCNCCCc1ccc(-c2cncc(C(=O)Nc3cccnc3)n2)cc1 |
| InChI | InChI=1S/C23H27N5O2/c1-30-14-4-13-24-11-2-5-18-7-9-19(10-8-18)21-16-26-17-22(28-21)23(29)27-20-6-3-12-25-15-20/h3,6-10,12,15-17,24H,2,4-5,11,13-14H2,1H3,(H,27,29) |
| InChIKey | AEMQQLPEIBBEIQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|