C18H20F3NO — CID 86661816
2,2,2-trifluoro-1-(4-oct-1-ynyl-2,3-dihydroindol-1-yl)ethanone (PubChem CID 86661816) has the molecular formula C18H20F3NO and a molecular weight of 323.36 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(4-oct-1-ynyl-2,3-dihydroindol-1-yl)ethanone.
| Compound Name | 2,2,2-trifluoro-1-(4-oct-1-ynyl-2,3-dihydroindol-1-yl)ethanone |
|---|---|
| PubChem CID | 86661816 |
| Molecular Formula | C18H20F3NO |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 2,2,2-trifluoro-1-(4-oct-1-ynyl-2,3-dihydroindol-1-yl)ethanone |
| SMILES | CCCCCCC#Cc1cccc2c1CCN2C(=O)C(F)(F)F |
| InChI | InChI=1S/C18H20F3NO/c1-2-3-4-5-6-7-9-14-10-8-11-16-15(14)12-13-22(16)17(23)18(19,20)21/h8,10-11H,2-6,12-13H2,1H3 |
| InChIKey | XYXWEMKYFNCEMW-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|