C11H9ClN3O2- — CID 86668920
N-[[2-chloro-5-(1H-pyrazol-5-yl)phenyl]methyl]carbamate (PubChem CID 86668920) has the molecular formula C11H9ClN3O2- and a molecular weight of 250.67 g/mol. Its IUPAC name is N-[[2-chloro-5-(1H-pyrazol-5-yl)phenyl]methyl]carbamate.
| Compound Name | N-[[2-chloro-5-(1H-pyrazol-5-yl)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 86668920 |
| Molecular Formula | C11H9ClN3O2- |
| Molecular Weight | 250.67 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | N-[[2-chloro-5-(1H-pyrazol-5-yl)phenyl]methyl]carbamate |
| SMILES | O=C([O-])NCc1cc(-c2ccn[nH]2)ccc1Cl |
| InChI | InChI=1S/C11H10ClN3O2/c12-9-2-1-7(10-3-4-14-15-10)5-8(9)6-13-11(16)17/h1-5,13H,6H2,(H,14,15)(H,16,17)/p-1 |
| InChIKey | GMSBEHHASXIKMK-UHFFFAOYSA-M |
| XLogP | 1.16 |
| TPSA | 80.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.67 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |