C19H25F6N5O3 — CID 86670354
9-[[(2R)-1-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)pyrimidin-2-yl]piperazin-2-yl]methyl]-3-oxa-9-azabicyclo[3.3.1]nonan-7-ol (PubChem CID 86670354) has the molecular formula C19H25F6N5O3 and a molecular weight of 485.43 g/mol. Its IUPAC name is 9-[[(2R)-1-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)pyrimidin-2-yl]piperazin-2-yl]methyl]-3-oxa-9-azabicyclo[3.3.1]nonan-7-ol.
| Compound Name | 9-[[(2R)-1-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)pyrimidin-2-yl]piperazin-2-yl]methyl]-3-oxa-9-azabicyclo[3.3.1]nonan-7-ol |
|---|---|
| PubChem CID | 86670354 |
| Molecular Formula | C19H25F6N5O3 |
| Molecular Weight | 485.43 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | 9-[[(2R)-1-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)pyrimidin-2-yl]piperazin-2-yl]methyl]-3-oxa-9-azabicyclo[3.3.1]nonan-7-ol |
| SMILES | OC1CC2COCC(C1)N2C[C@H]1CNCCN1c1ncc(C(O)(C(F)(F)F)C(F)(F)F)cn1 |
| InChI | InChI=1S/C19H25F6N5O3/c20-18(21,22)17(32,19(23,24)25)11-5-27-16(28-6-11)29-2-1-26-7-14(29)8-30-12-3-15(31)4-13(30)10-33-9-12/h5-6,12-15,26,31-32H,1-4,7-10H2/t12?,13?,14-,15?/m1/s1 |
| InChIKey | XGJNSYZZRJGGIT-MIGSVPMKSA-N |
| XLogP | 0.79 |
| TPSA | 93.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.43 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |