C19H24F9N5O4 — CID 87058308
1,1,1,3,3,3-hexafluoro-2-[2-[2-[(3-methylmorpholin-4-yl)methyl]piperazin-1-yl]pyrimidin-5-yl]propan-2-ol;2,2,2-trifluoroacetic acid (PubChem CID 87058308) has the molecular formula C19H24F9N5O4 and a molecular weight of 557.41 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[2-[2-[(3-methylmorpholin-4-yl)methyl]piperazin-1-yl]pyrimidin-5-yl]propan-2-ol;2,2,2-trifluoroacetic acid.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[2-[2-[(3-methylmorpholin-4-yl)methyl]piperazin-1-yl]pyrimidin-5-yl]propan-2-ol;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87058308 |
| Molecular Formula | C19H24F9N5O4 |
| Molecular Weight | 557.41 g/mol |
| Exact Mass | 557.17 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[2-[2-[(3-methylmorpholin-4-yl)methyl]piperazin-1-yl]pyrimidin-5-yl]propan-2-ol;2,2,2-trifluoroacetic acid |
| SMILES | CC1COCCN1CC1CNCCN1c1ncc(C(O)(C(F)(F)F)C(F)(F)F)cn1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H23F6N5O2.C2HF3O2/c1-11-10-30-5-4-27(11)9-13-8-24-2-3-28(13)14-25-6-12(7-26-14)15(29,16(18,19)20)17(21,22)23;3-2(4,5)1(6)7/h6-7,11,13,24,29H,2-5,8-10H2,1H3;(H,6,7) |
| InChIKey | NVSRAOLZMYQIOV-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 111.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.41 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |