C9H16N2O4 — CID 86671358
methyl 2-[[(2S)-2-amino-3-prop-2-enoxypropanoyl]amino]acetate (PubChem CID 86671358) has the molecular formula C9H16N2O4 and a molecular weight of 216.24 g/mol. Its IUPAC name is methyl 2-[[(2S)-2-amino-3-prop-2-enoxypropanoyl]amino]acetate.
| Compound Name | methyl 2-[[(2S)-2-amino-3-prop-2-enoxypropanoyl]amino]acetate |
|---|---|
| PubChem CID | 86671358 |
| Molecular Formula | C9H16N2O4 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | methyl 2-[[(2S)-2-amino-3-prop-2-enoxypropanoyl]amino]acetate |
| SMILES | C=CCOC[C@H](N)C(=O)NCC(=O)OC |
| InChI | InChI=1S/C9H16N2O4/c1-3-4-15-6-7(10)9(13)11-5-8(12)14-2/h3,7H,1,4-6,10H2,2H3,(H,11,13)/t7-/m0/s1 |
| InChIKey | AAQRTROWXMASLC-ZETCQYMHSA-N |
| XLogP | -1.19 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|